C14H28N2 — CID 123843490
N',N'-diethyl-N-(2-ethylidenepent-3-enyl)-N-methylethane-1,2-diamine (PubChem CID 123843490) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is N',N'-diethyl-N-(2-ethylidenepent-3-enyl)-N-methylethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-(2-ethylidenepent-3-enyl)-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 123843490 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | N',N'-diethyl-N-(2-ethylidenepent-3-enyl)-N-methylethane-1,2-diamine |
| SMILES | CC=CC(=CC)CN(C)CCN(CC)CC |
| InChI | InChI=1S/C14H28N2/c1-6-10-14(7-2)13-15(5)11-12-16(8-3)9-4/h6-7,10H,8-9,11-13H2,1-5H3 |
| InChIKey | GXHNDSIQPHREDO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|