C22H36N2O7S — CID 123844541
2-[[5-hydroxy-2-[(4-methylphenyl)sulfonylamino]-5-[(2-methylpropan-2-yl)oxy]pentanoyl]amino]-3-methylpentanoic acid (PubChem CID 123844541) has the molecular formula C22H36N2O7S and a molecular weight of 472.60 g/mol. Its IUPAC name is 2-[[5-hydroxy-2-[(4-methylphenyl)sulfonylamino]-5-[(2-methylpropan-2-yl)oxy]pentanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[5-hydroxy-2-[(4-methylphenyl)sulfonylamino]-5-[(2-methylpropan-2-yl)oxy]pentanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 123844541 |
| Molecular Formula | C22H36N2O7S |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 2-[[5-hydroxy-2-[(4-methylphenyl)sulfonylamino]-5-[(2-methylpropan-2-yl)oxy]pentanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCC(O)OC(C)(C)C)NS(=O)(=O)c1ccc(C)cc1)C(=O)O |
| InChI | InChI=1S/C22H36N2O7S/c1-7-15(3)19(21(27)28)23-20(26)17(12-13-18(25)31-22(4,5)6)24-32(29,30)16-10-8-14(2)9-11-16/h8-11,15,17-19,24-25H,7,12-13H2,1-6H3,(H,23,26)(H,27,28) |
| InChIKey | GHGKRWVNCYRIQF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|