C10H15F3O2 — CID 123845088
(Z)-3-ethyl-1,1,1-trifluoro-4-propan-2-yloxypent-3-en-2-one (PubChem CID 123845088) has the molecular formula C10H15F3O2 and a molecular weight of 224.22 g/mol. Its IUPAC name is (Z)-3-ethyl-1,1,1-trifluoro-4-propan-2-yloxypent-3-en-2-one.
| Compound Name | (Z)-3-ethyl-1,1,1-trifluoro-4-propan-2-yloxypent-3-en-2-one |
|---|---|
| PubChem CID | 123845088 |
| Molecular Formula | C10H15F3O2 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (Z)-3-ethyl-1,1,1-trifluoro-4-propan-2-yloxypent-3-en-2-one |
| SMILES | CC/C(C(=O)C(F)(F)F)=C(\C)OC(C)C |
| InChI | InChI=1S/C10H15F3O2/c1-5-8(7(4)15-6(2)3)9(14)10(11,12)13/h6H,5H2,1-4H3/b8-7- |
| InChIKey | ABSLMMQIFPOHAM-FPLPWBNLSA-N |
| XLogP | 3.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|