C20H23F2N4O2+ — CID 123845711
2-(2,4-difluorophenoxy)-N-(3,3-dimethylbutan-2-yl)-4-methyl-5H-pyrrolo[2,3-b]pyrazin-4-ium-7-carboxamide (PubChem CID 123845711) has the molecular formula C20H23F2N4O2+ and a molecular weight of 389.43 g/mol. Its IUPAC name is 2-(2,4-difluorophenoxy)-N-(3,3-dimethylbutan-2-yl)-4-methyl-5H-pyrrolo[2,3-b]pyrazin-4-ium-7-carboxamide.
| Compound Name | 2-(2,4-difluorophenoxy)-N-(3,3-dimethylbutan-2-yl)-4-methyl-5H-pyrrolo[2,3-b]pyrazin-4-ium-7-carboxamide |
|---|---|
| PubChem CID | 123845711 |
| Molecular Formula | C20H23F2N4O2+ |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 2-(2,4-difluorophenoxy)-N-(3,3-dimethylbutan-2-yl)-4-methyl-5H-pyrrolo[2,3-b]pyrazin-4-ium-7-carboxamide |
| SMILES | CC(NC(=O)c1c[nH]c2c1nc(Oc1ccc(F)cc1F)c[n+]2C)C(C)(C)C |
| InChI | InChI=1S/C20H22F2N4O2/c1-11(20(2,3)4)24-19(27)13-9-23-18-17(13)25-16(10-26(18)5)28-15-7-6-12(21)8-14(15)22/h6-11H,1-5H3,(H,24,27)/p+1 |
| InChIKey | JDLZRKCIZINZIZ-UHFFFAOYSA-O |
| XLogP | 3.62 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|