C9H14F6O2 — CID 123845932
1,1,1-trifluoro-2-(methoxymethoxy)-3-methyl-2-(trifluoromethyl)pentane (PubChem CID 123845932) has the molecular formula C9H14F6O2 and a molecular weight of 268.20 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(methoxymethoxy)-3-methyl-2-(trifluoromethyl)pentane.
| Compound Name | 1,1,1-trifluoro-2-(methoxymethoxy)-3-methyl-2-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 123845932 |
| Molecular Formula | C9H14F6O2 |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 1,1,1-trifluoro-2-(methoxymethoxy)-3-methyl-2-(trifluoromethyl)pentane |
| SMILES | CCC(C)C(OCOC)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H14F6O2/c1-4-6(2)7(8(10,11)12,9(13,14)15)17-5-16-3/h6H,4-5H2,1-3H3 |
| InChIKey | MLQFGWLVIATRNQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|