C12H21N — CID 123847631
6-butan-2-yl-5-ethyl-3-methyl-2,3-dihydropyridine (PubChem CID 123847631) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 6-butan-2-yl-5-ethyl-3-methyl-2,3-dihydropyridine.
| Compound Name | 6-butan-2-yl-5-ethyl-3-methyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 123847631 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 6-butan-2-yl-5-ethyl-3-methyl-2,3-dihydropyridine |
| SMILES | CCC1=CC(C)CN=C1C(C)CC |
| InChI | InChI=1S/C12H21N/c1-5-10(4)12-11(6-2)7-9(3)8-13-12/h7,9-10H,5-6,8H2,1-4H3 |
| InChIKey | ONIIZESMRMZRJA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |