C18H18IN3O3S — CID 1238479
(2R)-N-(4-iodo-2-methylphenyl)-1-(2-nitrophenyl)sulfanylpyrrolidine-2-carboxamide (PubChem CID 1238479) has the molecular formula C18H18IN3O3S and a molecular weight of 483.33 g/mol. Its IUPAC name is (2R)-N-(4-iodo-2-methylphenyl)-1-(2-nitrophenyl)sulfanylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(4-iodo-2-methylphenyl)-1-(2-nitrophenyl)sulfanylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 1238479 |
| Molecular Formula | C18H18IN3O3S |
| Molecular Weight | 483.33 g/mol |
| Exact Mass | 483.01 |
| IUPAC Name | (2R)-N-(4-iodo-2-methylphenyl)-1-(2-nitrophenyl)sulfanylpyrrolidine-2-carboxamide |
| SMILES | Cc1cc(I)ccc1NC(=O)[C@H]1CCCN1Sc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18IN3O3S/c1-12-11-13(19)8-9-14(12)20-18(23)16-6-4-10-21(16)26-17-7-3-2-5-15(17)22(24)25/h2-3,5,7-9,11,16H,4,6,10H2,1H3,(H,20,23)/t16-/m1/s1 |
| InChIKey | HYYBNQALAIBMHY-MRXNPFEDSA-N |
| XLogP | 4.62 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.33 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|