C19H19N5O2S — CID 123848107
4-methyl-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-N-prop-2-enoxy-5,6-dihydro-[1,3]oxazolo[5,4-b]pyridin-7-imine (PubChem CID 123848107) has the molecular formula C19H19N5O2S and a molecular weight of 381.46 g/mol. Its IUPAC name is 4-methyl-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-N-prop-2-enoxy-5,6-dihydro-[1,3]oxazolo[5,4-b]pyridin-7-imine.
| Compound Name | 4-methyl-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-N-prop-2-enoxy-5,6-dihydro-[1,3]oxazolo[5,4-b]pyridin-7-imine |
|---|---|
| PubChem CID | 123848107 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 4-methyl-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-N-prop-2-enoxy-5,6-dihydro-[1,3]oxazolo[5,4-b]pyridin-7-imine |
| SMILES | C=CCON=C1CCN(C)c2oc(-c3sc(-c4cccnc4)nc3C)nc21 |
| InChI | InChI=1S/C19H19N5O2S/c1-4-10-25-23-14-7-9-24(3)19-15(14)22-17(26-19)16-12(2)21-18(27-16)13-6-5-8-20-11-13/h4-6,8,11H,1,7,9-10H2,2-3H3 |
| InChIKey | SFYQYALCUVWGCN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 76.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|