C20H22N6OS — CID 118081640
(E)-5-methyl-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-N-propoxy-6,7-dihydropyrido[2,3-b]pyrazin-8-imine (PubChem CID 118081640) has the molecular formula C20H22N6OS and a molecular weight of 394.50 g/mol. Its IUPAC name is (E)-5-methyl-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-N-propoxy-6,7-dihydropyrido[2,3-b]pyrazin-8-imine.
| Compound Name | (E)-5-methyl-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-N-propoxy-6,7-dihydropyrido[2,3-b]pyrazin-8-imine |
|---|---|
| PubChem CID | 118081640 |
| Molecular Formula | C20H22N6OS |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (E)-5-methyl-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-N-propoxy-6,7-dihydropyrido[2,3-b]pyrazin-8-imine |
| SMILES | CCCO/N=C1\CCN(C)c2ncc(-c3sc(-c4cccnc4)nc3C)nc21 |
| InChI | InChI=1S/C20H22N6OS/c1-4-10-27-25-15-7-9-26(3)19-17(15)24-16(12-22-19)18-13(2)23-20(28-18)14-6-5-8-21-11-14/h5-6,8,11-12H,4,7,9-10H2,1-3H3/b25-15+ |
| InChIKey | SNVKLXIGQSJXCP-MFKUBSTISA-N |
| XLogP | 3.94 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|