C18H18N4OS2 — CID 123375991
N-ethoxy-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-1,3-benzothiazol-4-imine (PubChem CID 123375991) has the molecular formula C18H18N4OS2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N-ethoxy-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-1,3-benzothiazol-4-imine.
| Compound Name | N-ethoxy-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-1,3-benzothiazol-4-imine |
|---|---|
| PubChem CID | 123375991 |
| Molecular Formula | C18H18N4OS2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N-ethoxy-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-1,3-benzothiazol-4-imine |
| SMILES | CCON=C1CCCc2sc(-c3sc(-c4cccnc4)nc3C)nc21 |
| InChI | InChI=1S/C18H18N4OS2/c1-3-23-22-13-7-4-8-14-15(13)21-18(24-14)16-11(2)20-17(25-16)12-6-5-9-19-10-12/h5-6,9-10H,3-4,7-8H2,1-2H3 |
| InChIKey | OWGDOKCGJKSBLI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 60.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|