C16H14N4OS3 — CID 118073291
(E)-N-methoxy-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-5,6-dihydrothiopyrano[3,2-d][1,3]thiazol-7-imine (PubChem CID 118073291) has the molecular formula C16H14N4OS3 and a molecular weight of 374.52 g/mol. Its IUPAC name is (E)-N-methoxy-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-5,6-dihydrothiopyrano[3,2-d][1,3]thiazol-7-imine.
| Compound Name | (E)-N-methoxy-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-5,6-dihydrothiopyrano[3,2-d][1,3]thiazol-7-imine |
|---|---|
| PubChem CID | 118073291 |
| Molecular Formula | C16H14N4OS3 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | (E)-N-methoxy-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-5,6-dihydrothiopyrano[3,2-d][1,3]thiazol-7-imine |
| SMILES | CO/N=C1\CCSc2sc(-c3sc(-c4cccnc4)nc3C)nc21 |
| InChI | InChI=1S/C16H14N4OS3/c1-9-13(23-14(18-9)10-4-3-6-17-8-10)15-19-12-11(20-21-2)5-7-22-16(12)24-15/h3-4,6,8H,5,7H2,1-2H3/b20-11+ |
| InChIKey | SCYUZAKJSLDVBO-RGVLZGJSSA-N |
| XLogP | 4.48 |
| TPSA | 60.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|