C20H19N5O2S — CID 123621011
methyl N-[[2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-ylidene]amino]carbamate (PubChem CID 123621011) has the molecular formula C20H19N5O2S and a molecular weight of 393.47 g/mol. Its IUPAC name is methyl N-[[2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-ylidene]amino]carbamate.
| Compound Name | methyl N-[[2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-ylidene]amino]carbamate |
|---|---|
| PubChem CID | 123621011 |
| Molecular Formula | C20H19N5O2S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | methyl N-[[2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-ylidene]amino]carbamate |
| SMILES | COC(=O)NN=C1CCCc2ccc(-c3sc(-c4cccnc4)nc3C)nc21 |
| InChI | InChI=1S/C20H19N5O2S/c1-12-18(28-19(22-12)14-6-4-10-21-11-14)16-9-8-13-5-3-7-15(17(13)23-16)24-25-20(26)27-2/h4,6,8-11H,3,5,7H2,1-2H3,(H,25,26) |
| InChIKey | LKFNFBLZTGGUDO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|