C23H20N6S — CID 118081833
N-[(E)-[2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-ylidene]amino]pyridin-2-amine (PubChem CID 118081833) has the molecular formula C23H20N6S and a molecular weight of 412.52 g/mol. Its IUPAC name is N-[(E)-[2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-ylidene]amino]pyridin-2-amine.
| Compound Name | N-[(E)-[2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-ylidene]amino]pyridin-2-amine |
|---|---|
| PubChem CID | 118081833 |
| Molecular Formula | C23H20N6S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N-[(E)-[2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-ylidene]amino]pyridin-2-amine |
| SMILES | Cc1nc(-c2cccnc2)sc1-c1ccc2c(n1)/C(=N/Nc1ccccn1)CCC2 |
| InChI | InChI=1S/C23H20N6S/c1-15-22(30-23(26-15)17-7-5-12-24-14-17)19-11-10-16-6-4-8-18(21(16)27-19)28-29-20-9-2-3-13-25-20/h2-3,5,7,9-14H,4,6,8H2,1H3,(H,25,29)/b28-18+ |
| InChIKey | VSPYCYBYLYIKRT-MTDXEUNCSA-N |
| XLogP | 5.12 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|