C19H17N5O2S — CID 123865812
methyl N-[[2-(2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-ylidene]amino]carbamate (PubChem CID 123865812) has the molecular formula C19H17N5O2S and a molecular weight of 379.45 g/mol. Its IUPAC name is methyl N-[[2-(2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-ylidene]amino]carbamate.
| Compound Name | methyl N-[[2-(2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-ylidene]amino]carbamate |
|---|---|
| PubChem CID | 123865812 |
| Molecular Formula | C19H17N5O2S |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | methyl N-[[2-(2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-ylidene]amino]carbamate |
| SMILES | COC(=O)NN=C1CCCc2ccc(-c3cnc(-c4cccnc4)s3)nc21 |
| InChI | InChI=1S/C19H17N5O2S/c1-26-19(25)24-23-15-6-2-4-12-7-8-14(22-17(12)15)16-11-21-18(27-16)13-5-3-9-20-10-13/h3,5,7-11H,2,4,6H2,1H3,(H,24,25) |
| InChIKey | LWIGTHMGFLBBLB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|