C16H14N6OS — CID 118081704
(E)-N-methoxy-3-(2-pyridin-3-yl-1,3-thiazol-5-yl)-7,8-dihydro-6H-1,2,4-benzotriazin-5-imine (PubChem CID 118081704) has the molecular formula C16H14N6OS and a molecular weight of 338.40 g/mol. Its IUPAC name is (E)-N-methoxy-3-(2-pyridin-3-yl-1,3-thiazol-5-yl)-7,8-dihydro-6H-1,2,4-benzotriazin-5-imine.
| Compound Name | (E)-N-methoxy-3-(2-pyridin-3-yl-1,3-thiazol-5-yl)-7,8-dihydro-6H-1,2,4-benzotriazin-5-imine |
|---|---|
| PubChem CID | 118081704 |
| Molecular Formula | C16H14N6OS |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (E)-N-methoxy-3-(2-pyridin-3-yl-1,3-thiazol-5-yl)-7,8-dihydro-6H-1,2,4-benzotriazin-5-imine |
| SMILES | CO/N=C1\CCCc2nnc(-c3cnc(-c4cccnc4)s3)nc21 |
| InChI | InChI=1S/C16H14N6OS/c1-23-22-12-6-2-5-11-14(12)19-15(21-20-11)13-9-18-16(24-13)10-4-3-7-17-8-10/h3-4,7-9H,2,5-6H2,1H3/b22-12+ |
| InChIKey | AAXKSTAAFYZCPZ-WSDLNYQXSA-N |
| XLogP | 2.74 |
| TPSA | 86.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|