C17H14N6O2S — CID 118081713
(E)-N-prop-2-enoxy-3-(2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydropyrano[3,2-e][1,2,4]triazin-5-imine (PubChem CID 118081713) has the molecular formula C17H14N6O2S and a molecular weight of 366.41 g/mol. Its IUPAC name is (E)-N-prop-2-enoxy-3-(2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydropyrano[3,2-e][1,2,4]triazin-5-imine.
| Compound Name | (E)-N-prop-2-enoxy-3-(2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydropyrano[3,2-e][1,2,4]triazin-5-imine |
|---|---|
| PubChem CID | 118081713 |
| Molecular Formula | C17H14N6O2S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | (E)-N-prop-2-enoxy-3-(2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydropyrano[3,2-e][1,2,4]triazin-5-imine |
| SMILES | C=CCO/N=C1\CCOc2nnc(-c3cnc(-c4cccnc4)s3)nc21 |
| InChI | InChI=1S/C17H14N6O2S/c1-2-7-25-23-12-5-8-24-16-14(12)20-15(21-22-16)13-10-19-17(26-13)11-4-3-6-18-9-11/h2-4,6,9-10H,1,5,7-8H2/b23-12+ |
| InChIKey | FWWNUXAPHJNFTO-FSJBWODESA-N |
| XLogP | 2.75 |
| TPSA | 95.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|