C18H19N7O3S2 — CID 118081723
(E)-8-methylsulfonyl-N-propan-2-yloxy-3-(2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydropyrido[3,2-e][1,2,4]triazin-5-imine (PubChem CID 118081723) has the molecular formula C18H19N7O3S2 and a molecular weight of 445.53 g/mol. Its IUPAC name is (E)-8-methylsulfonyl-N-propan-2-yloxy-3-(2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydropyrido[3,2-e][1,2,4]triazin-5-imine.
| Compound Name | (E)-8-methylsulfonyl-N-propan-2-yloxy-3-(2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydropyrido[3,2-e][1,2,4]triazin-5-imine |
|---|---|
| PubChem CID | 118081723 |
| Molecular Formula | C18H19N7O3S2 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | (E)-8-methylsulfonyl-N-propan-2-yloxy-3-(2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydropyrido[3,2-e][1,2,4]triazin-5-imine |
| SMILES | CC(C)O/N=C1\CCN(S(C)(=O)=O)c2nnc(-c3cnc(-c4cccnc4)s3)nc21 |
| InChI | InChI=1S/C18H19N7O3S2/c1-11(2)28-24-13-6-8-25(30(3,26)27)17-15(13)21-16(22-23-17)14-10-20-18(29-14)12-5-4-7-19-9-12/h4-5,7,9-11H,6,8H2,1-3H3/b24-13+ |
| InChIKey | PCMBVWLYEDCHGG-ZMOGYAJESA-N |
| XLogP | 2.36 |
| TPSA | 123.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|