C20H21N5OS — CID 118081538
(E)-1-methyl-N-propoxy-6-(2-pyridin-3-yl-1,3-thiazol-5-yl)-2,3-dihydro-1,5-naphthyridin-4-imine (PubChem CID 118081538) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is (E)-1-methyl-N-propoxy-6-(2-pyridin-3-yl-1,3-thiazol-5-yl)-2,3-dihydro-1,5-naphthyridin-4-imine.
| Compound Name | (E)-1-methyl-N-propoxy-6-(2-pyridin-3-yl-1,3-thiazol-5-yl)-2,3-dihydro-1,5-naphthyridin-4-imine |
|---|---|
| PubChem CID | 118081538 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (E)-1-methyl-N-propoxy-6-(2-pyridin-3-yl-1,3-thiazol-5-yl)-2,3-dihydro-1,5-naphthyridin-4-imine |
| SMILES | CCCO/N=C1\CCN(C)c2ccc(-c3cnc(-c4cccnc4)s3)nc21 |
| InChI | InChI=1S/C20H21N5OS/c1-3-11-26-24-16-8-10-25(2)17-7-6-15(23-19(16)17)18-13-22-20(27-18)14-5-4-9-21-12-14/h4-7,9,12-13H,3,8,10-11H2,1-2H3/b24-16+ |
| InChIKey | BUQBKJJYJIKNQY-LFVJCYFKSA-N |
| XLogP | 4.24 |
| TPSA | 63.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|