C16H13N5OS — CID 136949820
(NE)-N-[3-(2-pyridin-3-yl-1,3-thiazol-5-yl)-7,8-dihydro-6H-quinoxalin-5-ylidene]hydroxylamine (PubChem CID 136949820) has the molecular formula C16H13N5OS and a molecular weight of 323.38 g/mol. Its IUPAC name is (NE)-N-[3-(2-pyridin-3-yl-1,3-thiazol-5-yl)-7,8-dihydro-6H-quinoxalin-5-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[3-(2-pyridin-3-yl-1,3-thiazol-5-yl)-7,8-dihydro-6H-quinoxalin-5-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 136949820 |
| Molecular Formula | C16H13N5OS |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (NE)-N-[3-(2-pyridin-3-yl-1,3-thiazol-5-yl)-7,8-dihydro-6H-quinoxalin-5-ylidene]hydroxylamine |
| SMILES | O/N=C1\CCCc2ncc(-c3cnc(-c4cccnc4)s3)nc21 |
| InChI | InChI=1S/C16H13N5OS/c22-21-12-5-1-4-11-15(12)20-13(8-18-11)14-9-19-16(23-14)10-3-2-6-17-7-10/h2-3,6-9,22H,1,4-5H2/b21-12+ |
| InChIKey | DPOKVGFEPDKQGG-CIAFOILYSA-N |
| XLogP | 3.18 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|