C19H16N4OS — CID 123750915
5-[8-(oxiran-2-ylmethylidene)-6,7-dihydro-5H-quinoxalin-2-yl]-2-pyridin-3-yl-1,3-thiazole (PubChem CID 123750915) has the molecular formula C19H16N4OS and a molecular weight of 348.43 g/mol. Its IUPAC name is 5-[8-(oxiran-2-ylmethylidene)-6,7-dihydro-5H-quinoxalin-2-yl]-2-pyridin-3-yl-1,3-thiazole.
| Compound Name | 5-[8-(oxiran-2-ylmethylidene)-6,7-dihydro-5H-quinoxalin-2-yl]-2-pyridin-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 123750915 |
| Molecular Formula | C19H16N4OS |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 5-[8-(oxiran-2-ylmethylidene)-6,7-dihydro-5H-quinoxalin-2-yl]-2-pyridin-3-yl-1,3-thiazole |
| SMILES | C(=C1CCCc2ncc(-c3cnc(-c4cccnc4)s3)nc21)C1CO1 |
| InChI | InChI=1S/C19H16N4OS/c1-3-12(7-14-11-24-14)18-15(5-1)21-9-16(23-18)17-10-22-19(25-17)13-4-2-6-20-8-13/h2,4,6-10,14H,1,3,5,11H2 |
| InChIKey | AXOJQQXULCHJQJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 64.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|