C20H22N4OS — CID 148793923
N-propan-2-yloxy-2-(2-pyridin-3-yl-1,3-thiazol-5-yl)-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 148793923) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is N-propan-2-yloxy-2-(2-pyridin-3-yl-1,3-thiazol-5-yl)-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | N-propan-2-yloxy-2-(2-pyridin-3-yl-1,3-thiazol-5-yl)-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 148793923 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-propan-2-yloxy-2-(2-pyridin-3-yl-1,3-thiazol-5-yl)-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | CC(C)ONC1CCCc2ccc(-c3cnc(-c4cccnc4)s3)nc21 |
| InChI | InChI=1S/C20H22N4OS/c1-13(2)25-24-17-7-3-5-14-8-9-16(23-19(14)17)18-12-22-20(26-18)15-6-4-10-21-11-15/h4,6,8-13,17,24H,3,5,7H2,1-2H3 |
| InChIKey | OMSKWLLPGSHPMS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|