C25H23N5OS — CID 123932684
4-methoxy-N-[[2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-ylidene]amino]aniline (PubChem CID 123932684) has the molecular formula C25H23N5OS and a molecular weight of 441.56 g/mol. Its IUPAC name is 4-methoxy-N-[[2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-ylidene]amino]aniline.
| Compound Name | 4-methoxy-N-[[2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-ylidene]amino]aniline |
|---|---|
| PubChem CID | 123932684 |
| Molecular Formula | C25H23N5OS |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 4-methoxy-N-[[2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-ylidene]amino]aniline |
| SMILES | COc1ccc(NN=C2CCCc3ccc(-c4sc(-c5cccnc5)nc4C)nc32)cc1 |
| InChI | InChI=1S/C25H23N5OS/c1-16-24(32-25(27-16)18-6-4-14-26-15-18)22-13-8-17-5-3-7-21(23(17)28-22)30-29-19-9-11-20(31-2)12-10-19/h4,6,8-15,29H,3,5,7H2,1-2H3 |
| InChIKey | HOROHWALKQGKRW-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|