C22H23NO6 — CID 123849509
2-(hydroxymethyl)-6-[4-(quinolin-8-ylmethoxy)phenyl]oxane-3,4,5-triol (PubChem CID 123849509) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-[4-(quinolin-8-ylmethoxy)phenyl]oxane-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-6-[4-(quinolin-8-ylmethoxy)phenyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 123849509 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 2-(hydroxymethyl)-6-[4-(quinolin-8-ylmethoxy)phenyl]oxane-3,4,5-triol |
| SMILES | OCC1OC(c2ccc(OCc3cccc4cccnc34)cc2)C(O)C(O)C1O |
| InChI | InChI=1S/C22H23NO6/c24-11-17-19(25)20(26)21(27)22(29-17)14-6-8-16(9-7-14)28-12-15-4-1-3-13-5-2-10-23-18(13)15/h1-10,17,19-22,24-27H,11-12H2 |
| InChIKey | SBMJZUYVTXXCAQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |