C22H22N2O6 — CID 136721058
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-[(2-hydroxynaphthalen-1-yl)diazenyl]phenyl]oxane-3,4,5-triol (PubChem CID 136721058) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-[(2-hydroxynaphthalen-1-yl)diazenyl]phenyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-[(2-hydroxynaphthalen-1-yl)diazenyl]phenyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 136721058 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-[(2-hydroxynaphthalen-1-yl)diazenyl]phenyl]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(/N=N/c3c(O)ccc4ccccc34)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H22N2O6/c25-11-17-19(27)20(28)21(29)22(30-17)13-5-8-14(9-6-13)23-24-18-15-4-2-1-3-12(15)7-10-16(18)26/h1-10,17,19-22,25-29H,11H2/b24-23+/t17-,19-,20+,21-,22+/m1/s1 |
| InChIKey | LKNIUWRNHWLBLI-QBJRUGICSA-N |
| XLogP | 2.48 |
| TPSA | 135.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|