C19H30 — CID 123853087
5-(3,4-dimethylpent-4-en-2-yl)-2,5,6-trimethylnona-1,7-dien-3-yne (PubChem CID 123853087) has the molecular formula C19H30 and a molecular weight of 258.45 g/mol. Its IUPAC name is 5-(3,4-dimethylpent-4-en-2-yl)-2,5,6-trimethylnona-1,7-dien-3-yne.
| Compound Name | 5-(3,4-dimethylpent-4-en-2-yl)-2,5,6-trimethylnona-1,7-dien-3-yne |
|---|---|
| PubChem CID | 123853087 |
| Molecular Formula | C19H30 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 5-(3,4-dimethylpent-4-en-2-yl)-2,5,6-trimethylnona-1,7-dien-3-yne |
| SMILES | C=C(C)C#CC(C)(C(C)C=CC)C(C)C(C)C(=C)C |
| InChI | InChI=1S/C19H30/c1-10-11-16(6)19(9,13-12-14(2)3)18(8)17(7)15(4)5/h10-11,16-18H,2,4H2,1,3,5-9H3 |
| InChIKey | QHVSWECVJIQXFN-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|