About 1-(2,2-dimethylpropyl)-3,3-dimethyl-1-(2-methylbutan-2-yl)cycloheptane
1-(2,2-dimethylpropyl)-3,3-dimethyl-1-(2-methylbutan-2-yl)cycloheptane (PubChem CID 123853470) has the molecular formula C19H38
and a molecular weight of 266.51 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-3,3-dimethyl-1-(2-methylbutan-2-yl)cycloheptane.
Molecular Properties
| Compound Name | 1-(2,2-dimethylpropyl)-3,3-dimethyl-1-(2-methylbutan-2-yl)cycloheptane |
| PubChem CID | 123853470 |
| Molecular Formula | C19H38 |
| Molecular Weight | 266.51 g/mol |
| Exact Mass | 266.30 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-3,3-dimethyl-1-(2-methylbutan-2-yl)cycloheptane |
| SMILES | CCC(C)(C)C1(CC(C)(C)C)CCCCC(C)(C)C1 |
| InChI | InChI=1S/C19H38/c1-9-18(7,8)19(14-16(2,3)4)13-11-10-12-17(5,6)15-19/h9-15H2,1-8H3 |
| InChIKey | HUGGZUVSYWVQSX-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.51 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(2,2-dimethylpropyl)-3,3-dimethyl-1-(2-methylbutan-2-yl)cycloheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethylpropyl)-3,3-dimethyl-1-(2-methylbutan-2-yl)cycloheptane?
The IUPAC name of 1-(2,2-dimethylpropyl)-3,3-dimethyl-1-(2-methylbutan-2-yl)cycloheptane (CID 123853470) is 1-(2,2-dimethylpropyl)-3,3-dimethyl-1-(2-methylbutan-2-yl)cycloheptane.
What is the SMILES notation for 1-(2,2-dimethylpropyl)-3,3-dimethyl-1-(2-methylbutan-2-yl)cycloheptane?
The canonical SMILES for 1-(2,2-dimethylpropyl)-3,3-dimethyl-1-(2-methylbutan-2-yl)cycloheptane is CCC(C)(C)C1(CC(C)(C)C)CCCCC(C)(C)C1.
What is the InChIKey of 1-(2,2-dimethylpropyl)-3,3-dimethyl-1-(2-methylbutan-2-yl)cycloheptane?
The InChIKey is HUGGZUVSYWVQSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38/c1-9-18(7,8)19(14-16(2,3)4)13-11-10-12-17(5,6)15-19/h9-15H2,1-8H3.
What are the key properties of 1-(2,2-dimethylpropyl)-3,3-dimethyl-1-(2-methylbutan-2-yl)cycloheptane?
1-(2,2-dimethylpropyl)-3,3-dimethyl-1-(2-methylbutan-2-yl)cycloheptane has a molecular weight of 266.51 g/mol, XLogP of 6.84, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethylpropyl)-3,3-dimethyl-1-(2-methylbutan-2-yl)cycloheptane is sourced from PubChem (CID 123853470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).