C29H24F3N7O6 — CID 123856904
[1-[1-[[2-carbamoyl-3-(6-methoxy-3-pyridinyl)indolizin-7-yl]methyl]triazol-4-yl]-4,4,4-trifluorobutyl] 4-nitrobenzoate (PubChem CID 123856904) has the molecular formula C29H24F3N7O6 and a molecular weight of 623.55 g/mol. Its IUPAC name is [1-[1-[[2-carbamoyl-3-(6-methoxy-3-pyridinyl)indolizin-7-yl]methyl]triazol-4-yl]-4,4,4-trifluorobutyl] 4-nitrobenzoate.
| Compound Name | [1-[1-[[2-carbamoyl-3-(6-methoxy-3-pyridinyl)indolizin-7-yl]methyl]triazol-4-yl]-4,4,4-trifluorobutyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 123856904 |
| Molecular Formula | C29H24F3N7O6 |
| Molecular Weight | 623.55 g/mol |
| Exact Mass | 623.17 |
| IUPAC Name | [1-[1-[[2-carbamoyl-3-(6-methoxy-3-pyridinyl)indolizin-7-yl]methyl]triazol-4-yl]-4,4,4-trifluorobutyl] 4-nitrobenzoate |
| SMILES | COc1ccc(-c2c(C(N)=O)cc3cc(Cn4cc(C(CCC(F)(F)F)OC(=O)c5ccc([N+](=O)[O-])cc5)nn4)ccn23)cn1 |
| InChI | InChI=1S/C29H24F3N7O6/c1-44-25-7-4-19(14-34-25)26-22(27(33)40)13-21-12-17(9-11-38(21)26)15-37-16-23(35-36-37)24(8-10-29(30,31)32)45-28(41)18-2-5-20(6-3-18)39(42)43/h2-7,9,11-14,16,24H,8,10,15H2,1H3,(H2,33,40) |
| InChIKey | FIQDKOLGHCVUGQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 169.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|