C23H15BrF3N5O4S — CID 67417238
[2-[1-[(3-bromo-2-cyano-1-benzothiophen-6-yl)methyl]triazol-4-yl]-1,1,1-trifluorobutan-2-yl] 4-nitrobenzoate (PubChem CID 67417238) has the molecular formula C23H15BrF3N5O4S and a molecular weight of 594.37 g/mol. Its IUPAC name is [2-[1-[(3-bromo-2-cyano-1-benzothiophen-6-yl)methyl]triazol-4-yl]-1,1,1-trifluorobutan-2-yl] 4-nitrobenzoate.
| Compound Name | [2-[1-[(3-bromo-2-cyano-1-benzothiophen-6-yl)methyl]triazol-4-yl]-1,1,1-trifluorobutan-2-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 67417238 |
| Molecular Formula | C23H15BrF3N5O4S |
| Molecular Weight | 594.37 g/mol |
| Exact Mass | 593.00 |
| IUPAC Name | [2-[1-[(3-bromo-2-cyano-1-benzothiophen-6-yl)methyl]triazol-4-yl]-1,1,1-trifluorobutan-2-yl] 4-nitrobenzoate |
| SMILES | CCC(OC(=O)c1ccc([N+](=O)[O-])cc1)(c1cn(Cc2ccc3c(Br)c(C#N)sc3c2)nn1)C(F)(F)F |
| InChI | InChI=1S/C23H15BrF3N5O4S/c1-2-22(23(25,26)27,36-21(33)14-4-6-15(7-5-14)32(34)35)19-12-31(30-29-19)11-13-3-8-16-17(9-13)37-18(10-28)20(16)24/h3-9,12H,2,11H2,1H3 |
| InChIKey | MNMFJPUSHPIRCS-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 123.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.37 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|