C28H27F3N6O5 — CID 143730946
[(Z)-2-amino-1-[amino-[[2-cyano-4-(1-ethoxyethenyl)quinolin-7-yl]methyl]amino]-3-(trifluoromethyl)pent-1-en-3-yl] 4-nitrobenzoate (PubChem CID 143730946) has the molecular formula C28H27F3N6O5 and a molecular weight of 584.56 g/mol. Its IUPAC name is [(Z)-2-amino-1-[amino-[[2-cyano-4-(1-ethoxyethenyl)quinolin-7-yl]methyl]amino]-3-(trifluoromethyl)pent-1-en-3-yl] 4-nitrobenzoate.
| Compound Name | [(Z)-2-amino-1-[amino-[[2-cyano-4-(1-ethoxyethenyl)quinolin-7-yl]methyl]amino]-3-(trifluoromethyl)pent-1-en-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 143730946 |
| Molecular Formula | C28H27F3N6O5 |
| Molecular Weight | 584.56 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | [(Z)-2-amino-1-[amino-[[2-cyano-4-(1-ethoxyethenyl)quinolin-7-yl]methyl]amino]-3-(trifluoromethyl)pent-1-en-3-yl] 4-nitrobenzoate |
| SMILES | C=C(OCC)c1cc(C#N)nc2cc(CN(N)/C=C(\N)C(CC)(OC(=O)c3ccc([N+](=O)[O-])cc3)C(F)(F)F)ccc12 |
| InChI | InChI=1S/C28H27F3N6O5/c1-4-27(28(29,30)31,42-26(38)19-7-9-21(10-8-19)37(39)40)25(33)16-36(34)15-18-6-11-22-23(17(3)41-5-2)13-20(14-32)35-24(22)12-18/h6-13,16H,3-5,15,33-34H2,1-2H3/b25-16- |
| InChIKey | NUABJZMUKUIITN-XYGWBWBKSA-N |
| XLogP | 5.07 |
| TPSA | 170.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|