C28H20F3N7O4S — CID 66791140
[(2S)-2-[1-[[2-cyano-4-(2-methyl-1,3-thiazol-4-yl)quinolin-7-yl]methyl]triazol-4-yl]-1,1,1-trifluorobutan-2-yl] 4-nitrobenzoate (PubChem CID 66791140) has the molecular formula C28H20F3N7O4S and a molecular weight of 607.57 g/mol. Its IUPAC name is [(2S)-2-[1-[[2-cyano-4-(2-methyl-1,3-thiazol-4-yl)quinolin-7-yl]methyl]triazol-4-yl]-1,1,1-trifluorobutan-2-yl] 4-nitrobenzoate.
| Compound Name | [(2S)-2-[1-[[2-cyano-4-(2-methyl-1,3-thiazol-4-yl)quinolin-7-yl]methyl]triazol-4-yl]-1,1,1-trifluorobutan-2-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 66791140 |
| Molecular Formula | C28H20F3N7O4S |
| Molecular Weight | 607.57 g/mol |
| Exact Mass | 607.12 |
| IUPAC Name | [(2S)-2-[1-[[2-cyano-4-(2-methyl-1,3-thiazol-4-yl)quinolin-7-yl]methyl]triazol-4-yl]-1,1,1-trifluorobutan-2-yl] 4-nitrobenzoate |
| SMILES | CC[C@](OC(=O)c1ccc([N+](=O)[O-])cc1)(c1cn(Cc2ccc3c(-c4csc(C)n4)cc(C#N)nc3c2)nn1)C(F)(F)F |
| InChI | InChI=1S/C28H20F3N7O4S/c1-3-27(28(29,30)31,42-26(39)18-5-7-20(8-6-18)38(40)41)25-14-37(36-35-25)13-17-4-9-21-22(24-15-43-16(2)33-24)11-19(12-32)34-23(21)10-17/h4-11,14-15H,3,13H2,1-2H3/t27-/m0/s1 |
| InChIKey | ABJGUFVNGKHUFN-MHZLTWQESA-N |
| XLogP | 6.11 |
| TPSA | 149.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|