C25H20BrF3N4O4S — CID 67418497
[2-[1-[(2-bromo-3-cyclopropyl-1-benzothiophen-6-yl)methyl]triazol-4-yl]-1,1,1-trifluorobutan-2-yl] 4-nitrobenzoate (PubChem CID 67418497) has the molecular formula C25H20BrF3N4O4S and a molecular weight of 609.42 g/mol. Its IUPAC name is [2-[1-[(2-bromo-3-cyclopropyl-1-benzothiophen-6-yl)methyl]triazol-4-yl]-1,1,1-trifluorobutan-2-yl] 4-nitrobenzoate.
| Compound Name | [2-[1-[(2-bromo-3-cyclopropyl-1-benzothiophen-6-yl)methyl]triazol-4-yl]-1,1,1-trifluorobutan-2-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 67418497 |
| Molecular Formula | C25H20BrF3N4O4S |
| Molecular Weight | 609.42 g/mol |
| Exact Mass | 608.03 |
| IUPAC Name | [2-[1-[(2-bromo-3-cyclopropyl-1-benzothiophen-6-yl)methyl]triazol-4-yl]-1,1,1-trifluorobutan-2-yl] 4-nitrobenzoate |
| SMILES | CCC(OC(=O)c1ccc([N+](=O)[O-])cc1)(c1cn(Cc2ccc3c(C4CC4)c(Br)sc3c2)nn1)C(F)(F)F |
| InChI | InChI=1S/C25H20BrF3N4O4S/c1-2-24(25(27,28)29,37-23(34)16-6-8-17(9-7-16)33(35)36)20-13-32(31-30-20)12-14-3-10-18-19(11-14)38-22(26)21(18)15-4-5-15/h3,6-11,13,15H,2,4-5,12H2,1H3 |
| InChIKey | SXTLVQRRRQBYSR-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 100.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.42 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|