C31H27F3N6O6 — CID 67036535
ethyl 3-(6-methyl-3-pyridinyl)-7-[[4-[1,1,1-trifluoro-2-(4-nitrobenzoyl)oxybutan-2-yl]triazol-1-yl]methyl]indolizine-2-carboxylate (PubChem CID 67036535) has the molecular formula C31H27F3N6O6 and a molecular weight of 636.59 g/mol. Its IUPAC name is ethyl 3-(6-methyl-3-pyridinyl)-7-[[4-[1,1,1-trifluoro-2-(4-nitrobenzoyl)oxybutan-2-yl]triazol-1-yl]methyl]indolizine-2-carboxylate.
| Compound Name | ethyl 3-(6-methyl-3-pyridinyl)-7-[[4-[1,1,1-trifluoro-2-(4-nitrobenzoyl)oxybutan-2-yl]triazol-1-yl]methyl]indolizine-2-carboxylate |
|---|---|
| PubChem CID | 67036535 |
| Molecular Formula | C31H27F3N6O6 |
| Molecular Weight | 636.59 g/mol |
| Exact Mass | 636.19 |
| IUPAC Name | ethyl 3-(6-methyl-3-pyridinyl)-7-[[4-[1,1,1-trifluoro-2-(4-nitrobenzoyl)oxybutan-2-yl]triazol-1-yl]methyl]indolizine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(Cn3cc(C(CC)(OC(=O)c4ccc([N+](=O)[O-])cc4)C(F)(F)F)nn3)ccn2c1-c1ccc(C)nc1 |
| InChI | InChI=1S/C31H27F3N6O6/c1-4-30(31(32,33)34,46-28(41)21-8-10-23(11-9-21)40(43)44)26-18-38(37-36-26)17-20-12-13-39-24(14-20)15-25(29(42)45-5-2)27(39)22-7-6-19(3)35-16-22/h6-16,18H,4-5,17H2,1-3H3 |
| InChIKey | GUYVSEHRFOWDCG-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 143.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.59 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|