C29H21F3N6O5S — CID 67418794
[2-[1-[[2-cyano-3-(6-methoxy-3-pyridinyl)-1-benzothiophen-6-yl]methyl]triazol-4-yl]-1,1,1-trifluorobutan-2-yl] 4-nitrobenzoate (PubChem CID 67418794) has the molecular formula C29H21F3N6O5S and a molecular weight of 622.59 g/mol. Its IUPAC name is [2-[1-[[2-cyano-3-(6-methoxy-3-pyridinyl)-1-benzothiophen-6-yl]methyl]triazol-4-yl]-1,1,1-trifluorobutan-2-yl] 4-nitrobenzoate.
| Compound Name | [2-[1-[[2-cyano-3-(6-methoxy-3-pyridinyl)-1-benzothiophen-6-yl]methyl]triazol-4-yl]-1,1,1-trifluorobutan-2-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 67418794 |
| Molecular Formula | C29H21F3N6O5S |
| Molecular Weight | 622.59 g/mol |
| Exact Mass | 622.12 |
| IUPAC Name | [2-[1-[[2-cyano-3-(6-methoxy-3-pyridinyl)-1-benzothiophen-6-yl]methyl]triazol-4-yl]-1,1,1-trifluorobutan-2-yl] 4-nitrobenzoate |
| SMILES | CCC(OC(=O)c1ccc([N+](=O)[O-])cc1)(c1cn(Cc2ccc3c(-c4ccc(OC)nc4)c(C#N)sc3c2)nn1)C(F)(F)F |
| InChI | InChI=1S/C29H21F3N6O5S/c1-3-28(29(30,31)32,43-27(39)18-5-8-20(9-6-18)38(40)41)24-16-37(36-35-24)15-17-4-10-21-22(12-17)44-23(13-33)26(21)19-7-11-25(42-2)34-14-19/h4-12,14,16H,3,15H2,1-2H3 |
| InChIKey | JLQJHKKQHUHNMI-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 146.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.59 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|