C19H28O3 — CID 123857626
5a,9b-dimethyl-6-(3-oxobutyl)-3,3a,4,5,6,8,9,9a-octahydro-1H-cyclopenta[a]naphthalene-2,7-dione (PubChem CID 123857626) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is 5a,9b-dimethyl-6-(3-oxobutyl)-3,3a,4,5,6,8,9,9a-octahydro-1H-cyclopenta[a]naphthalene-2,7-dione.
| Compound Name | 5a,9b-dimethyl-6-(3-oxobutyl)-3,3a,4,5,6,8,9,9a-octahydro-1H-cyclopenta[a]naphthalene-2,7-dione |
|---|---|
| PubChem CID | 123857626 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 5a,9b-dimethyl-6-(3-oxobutyl)-3,3a,4,5,6,8,9,9a-octahydro-1H-cyclopenta[a]naphthalene-2,7-dione |
| SMILES | CC(=O)CCC1C(=O)CCC2C3(C)CC(=O)CC3CCC12C |
| InChI | InChI=1S/C19H28O3/c1-12(20)4-5-15-16(22)6-7-17-18(15,2)9-8-13-10-14(21)11-19(13,17)3/h13,15,17H,4-11H2,1-3H3 |
| InChIKey | FSWSULSLIYHPIN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |