C10H13Cl3N2O6 — CID 123858956
(2S,4S)-4-[methyl(2,2,2-trichloroethoxycarbonyl)amino]pyrrolidine-1,2-dicarboxylic acid (PubChem CID 123858956) has the molecular formula C10H13Cl3N2O6 and a molecular weight of 363.58 g/mol. Its IUPAC name is (2S,4S)-4-[methyl(2,2,2-trichloroethoxycarbonyl)amino]pyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (2S,4S)-4-[methyl(2,2,2-trichloroethoxycarbonyl)amino]pyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 123858956 |
| Molecular Formula | C10H13Cl3N2O6 |
| Molecular Weight | 363.58 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | (2S,4S)-4-[methyl(2,2,2-trichloroethoxycarbonyl)amino]pyrrolidine-1,2-dicarboxylic acid |
| SMILES | CN(C(=O)OCC(Cl)(Cl)Cl)[C@H]1C[C@@H](C(=O)O)N(C(=O)O)C1 |
| InChI | InChI=1S/C10H13Cl3N2O6/c1-14(9(20)21-4-10(11,12)13)5-2-6(7(16)17)15(3-5)8(18)19/h5-6H,2-4H2,1H3,(H,16,17)(H,18,19)/t5-,6-/m0/s1 |
| InChIKey | MNHWRPPNKUMGGV-WDSKDSINSA-N |
| XLogP | 1.63 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.58 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|