C36H42ClF3N2O2 — CID 123859633
N-(1-benzylpiperidin-4-yl)-3-chloro-4-[4-methyl-5-[[3-(trifluoromethyl)phenyl]methyl]cyclooctyl]oxybenzamide (PubChem CID 123859633) has the molecular formula C36H42ClF3N2O2 and a molecular weight of 627.19 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-3-chloro-4-[4-methyl-5-[[3-(trifluoromethyl)phenyl]methyl]cyclooctyl]oxybenzamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-3-chloro-4-[4-methyl-5-[[3-(trifluoromethyl)phenyl]methyl]cyclooctyl]oxybenzamide |
|---|---|
| PubChem CID | 123859633 |
| Molecular Formula | C36H42ClF3N2O2 |
| Molecular Weight | 627.19 g/mol |
| Exact Mass | 626.29 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-3-chloro-4-[4-methyl-5-[[3-(trifluoromethyl)phenyl]methyl]cyclooctyl]oxybenzamide |
| SMILES | CC1CCC(Oc2ccc(C(=O)NC3CCN(Cc4ccccc4)CC3)cc2Cl)CCCC1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C36H42ClF3N2O2/c1-25-13-15-32(12-6-10-28(25)21-27-9-5-11-30(22-27)36(38,39)40)44-34-16-14-29(23-33(34)37)35(43)41-31-17-19-42(20-18-31)24-26-7-3-2-4-8-26/h2-5,7-9,11,14,16,22-23,25,28,31-32H,6,10,12-13,15,17-21,24H2,1H3,(H,41,43) |
| InChIKey | XCKNNXCYVGJPHF-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.19 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |