C14H22N4 — CID 123860955
1-N-(2-aminoethyl)-1-N-methyl-1-N'-phenyl-1-N'-(propan-2-ylideneamino)ethene-1,1-diamine (PubChem CID 123860955) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is 1-N-(2-aminoethyl)-1-N-methyl-1-N'-phenyl-1-N'-(propan-2-ylideneamino)ethene-1,1-diamine.
| Compound Name | 1-N-(2-aminoethyl)-1-N-methyl-1-N'-phenyl-1-N'-(propan-2-ylideneamino)ethene-1,1-diamine |
|---|---|
| PubChem CID | 123860955 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 1-N-(2-aminoethyl)-1-N-methyl-1-N'-phenyl-1-N'-(propan-2-ylideneamino)ethene-1,1-diamine |
| SMILES | C=C(N(C)CCN)N(N=C(C)C)c1ccccc1 |
| InChI | InChI=1S/C14H22N4/c1-12(2)16-18(13(3)17(4)11-10-15)14-8-6-5-7-9-14/h5-9H,3,10-11,15H2,1-2,4H3 |
| InChIKey | UCBXXYOVTMGTLV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|