C34H31F2N5O2S — CID 123861161
5-[[2-[benzyl-[4-[[2-(2,6-difluorophenyl)phenyl]methylamino]cyclohexyl]amino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 123861161) has the molecular formula C34H31F2N5O2S and a molecular weight of 611.72 g/mol. Its IUPAC name is 5-[[2-[benzyl-[4-[[2-(2,6-difluorophenyl)phenyl]methylamino]cyclohexyl]amino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[benzyl-[4-[[2-(2,6-difluorophenyl)phenyl]methylamino]cyclohexyl]amino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 123861161 |
| Molecular Formula | C34H31F2N5O2S |
| Molecular Weight | 611.72 g/mol |
| Exact Mass | 611.22 |
| IUPAC Name | 5-[[2-[benzyl-[4-[[2-(2,6-difluorophenyl)phenyl]methylamino]cyclohexyl]amino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccnc(N(Cc3ccccc3)C3CCC(NCc4ccccc4-c4c(F)cccc4F)CC3)n2)S1 |
| InChI | InChI=1S/C34H31F2N5O2S/c35-28-11-6-12-29(36)31(28)27-10-5-4-9-23(27)20-38-24-13-15-26(16-14-24)41(21-22-7-2-1-3-8-22)33-37-18-17-25(39-33)19-30-32(42)40-34(43)44-30/h1-12,17-19,24,26,38H,13-16,20-21H2,(H,40,42,43) |
| InChIKey | QIYXMTAOMOCLAC-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.72 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|