C31H22BrN5 — CID 123863317
(6-bromo-4-phenylquinolin-2-yl)-[(1,3-diphenylpyrazol-4-yl)methyl]diazene (PubChem CID 123863317) has the molecular formula C31H22BrN5 and a molecular weight of 544.46 g/mol. Its IUPAC name is (6-bromo-4-phenylquinolin-2-yl)-[(1,3-diphenylpyrazol-4-yl)methyl]diazene.
| Compound Name | (6-bromo-4-phenylquinolin-2-yl)-[(1,3-diphenylpyrazol-4-yl)methyl]diazene |
|---|---|
| PubChem CID | 123863317 |
| Molecular Formula | C31H22BrN5 |
| Molecular Weight | 544.46 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | (6-bromo-4-phenylquinolin-2-yl)-[(1,3-diphenylpyrazol-4-yl)methyl]diazene |
| SMILES | Brc1ccc2nc(/N=N/Cc3cn(-c4ccccc4)nc3-c3ccccc3)cc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C31H22BrN5/c32-25-16-17-29-28(18-25)27(22-10-4-1-5-11-22)19-30(34-29)35-33-20-24-21-37(26-14-8-3-9-15-26)36-31(24)23-12-6-2-7-13-23/h1-19,21H,20H2/b35-33+ |
| InChIKey | SYQWVTQVCVZJTI-LAPDZXRHSA-N |
| XLogP | 8.80 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.46 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|