C23H21N5O2 — CID 91897793
[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]methyl-pyridin-2-yldiazene (PubChem CID 91897793) has the molecular formula C23H21N5O2 and a molecular weight of 399.45 g/mol. Its IUPAC name is [3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]methyl-pyridin-2-yldiazene.
| Compound Name | [3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]methyl-pyridin-2-yldiazene |
|---|---|
| PubChem CID | 91897793 |
| Molecular Formula | C23H21N5O2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | [3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]methyl-pyridin-2-yldiazene |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2C/N=N/c2ccccn2)cc1OC |
| InChI | InChI=1S/C23H21N5O2/c1-29-20-12-11-17(14-21(20)30-2)23-18(15-25-26-22-10-6-7-13-24-22)16-28(27-23)19-8-4-3-5-9-19/h3-14,16H,15H2,1-2H3/b26-25+ |
| InChIKey | SMTDYHZCUXDVJE-OCEACIFDSA-N |
| XLogP | 5.24 |
| TPSA | 73.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|