About 8-ethylidene-3-azabicyclo[4.2.0]octa-1(6),2,4-triene
8-ethylidene-3-azabicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 123863751) has the molecular formula C9H9N
and a molecular weight of 131.18 g/mol. Its IUPAC name is 8-ethylidene-3-azabicyclo[4.2.0]octa-1(6),2,4-triene.
Analyze 8-ethylidene-3-azabicyclo[4.2.0]octa-1(6),2,4-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethylidene-3-azabicyclo[4.2.0]octa-1(6),2,4-triene?
The IUPAC name of 8-ethylidene-3-azabicyclo[4.2.0]octa-1(6),2,4-triene (CID 123863751) is 8-ethylidene-3-azabicyclo[4.2.0]octa-1(6),2,4-triene.
What is the SMILES notation for 8-ethylidene-3-azabicyclo[4.2.0]octa-1(6),2,4-triene?
The canonical SMILES for 8-ethylidene-3-azabicyclo[4.2.0]octa-1(6),2,4-triene is CC=C1Cc2ccncc21.
What is the InChIKey of 8-ethylidene-3-azabicyclo[4.2.0]octa-1(6),2,4-triene?
The InChIKey is POHLKNKRBVKOCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N/c1-2-7-5-8-3-4-10-6-9(7)8/h2-4,6H,5H2,1H3.
What are the key properties of 8-ethylidene-3-azabicyclo[4.2.0]octa-1(6),2,4-triene?
8-ethylidene-3-azabicyclo[4.2.0]octa-1(6),2,4-triene has a molecular weight of 131.18 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethylidene-3-azabicyclo[4.2.0]octa-1(6),2,4-triene is sourced from PubChem (CID 123863751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).