C12H18N2 — CID 123865726
1-[(4Z)-4-hexa-2,4-dienylidene-2,3-dihydropyrrol-2-yl]ethanamine (PubChem CID 123865726) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 1-[(4Z)-4-hexa-2,4-dienylidene-2,3-dihydropyrrol-2-yl]ethanamine.
| Compound Name | 1-[(4Z)-4-hexa-2,4-dienylidene-2,3-dihydropyrrol-2-yl]ethanamine |
|---|---|
| PubChem CID | 123865726 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 1-[(4Z)-4-hexa-2,4-dienylidene-2,3-dihydropyrrol-2-yl]ethanamine |
| SMILES | CC=CC=C/C=C1\C=NC(C(C)N)C1 |
| InChI | InChI=1S/C12H18N2/c1-3-4-5-6-7-11-8-12(10(2)13)14-9-11/h3-7,9-10,12H,8,13H2,1-2H3/b4-3?,6-5?,11-7- |
| InChIKey | QKRVUGLCOANSGS-JDHKOVSVSA-N |
| XLogP | 2.24 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|