C25H36N2O2 — CID 123866117
1-[2,5-dimethyl-1-(4-pentylphenyl)pyrrol-3-yl]-2-(4-methoxypiperidin-1-yl)ethanone (PubChem CID 123866117) has the molecular formula C25H36N2O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is 1-[2,5-dimethyl-1-(4-pentylphenyl)pyrrol-3-yl]-2-(4-methoxypiperidin-1-yl)ethanone.
| Compound Name | 1-[2,5-dimethyl-1-(4-pentylphenyl)pyrrol-3-yl]-2-(4-methoxypiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 123866117 |
| Molecular Formula | C25H36N2O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | 1-[2,5-dimethyl-1-(4-pentylphenyl)pyrrol-3-yl]-2-(4-methoxypiperidin-1-yl)ethanone |
| SMILES | CCCCCc1ccc(-n2c(C)cc(C(=O)CN3CCC(OC)CC3)c2C)cc1 |
| InChI | InChI=1S/C25H36N2O2/c1-5-6-7-8-21-9-11-22(12-10-21)27-19(2)17-24(20(27)3)25(28)18-26-15-13-23(29-4)14-16-26/h9-12,17,23H,5-8,13-16,18H2,1-4H3 |
| InChIKey | SNOYGWRYQDVTBD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|