C26H39N3O — CID 123702053
2-[4-(dimethylamino)piperidin-1-yl]-1-[2,5-dimethyl-1-(4-pentylphenyl)pyrrol-3-yl]ethanone (PubChem CID 123702053) has the molecular formula C26H39N3O and a molecular weight of 409.62 g/mol. Its IUPAC name is 2-[4-(dimethylamino)piperidin-1-yl]-1-[2,5-dimethyl-1-(4-pentylphenyl)pyrrol-3-yl]ethanone.
| Compound Name | 2-[4-(dimethylamino)piperidin-1-yl]-1-[2,5-dimethyl-1-(4-pentylphenyl)pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 123702053 |
| Molecular Formula | C26H39N3O |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 409.31 |
| IUPAC Name | 2-[4-(dimethylamino)piperidin-1-yl]-1-[2,5-dimethyl-1-(4-pentylphenyl)pyrrol-3-yl]ethanone |
| SMILES | CCCCCc1ccc(-n2c(C)cc(C(=O)CN3CCC(N(C)C)CC3)c2C)cc1 |
| InChI | InChI=1S/C26H39N3O/c1-6-7-8-9-22-10-12-24(13-11-22)29-20(2)18-25(21(29)3)26(30)19-28-16-14-23(15-17-28)27(4)5/h10-13,18,23H,6-9,14-17,19H2,1-5H3 |
| InChIKey | GVIKYZDOROPLJY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|