C23H33N3O — CID 123457525
1-[2,5-dimethyl-1-(4-pentylphenyl)imidazol-4-yl]-2-piperidin-1-ylethanone (PubChem CID 123457525) has the molecular formula C23H33N3O and a molecular weight of 367.54 g/mol. Its IUPAC name is 1-[2,5-dimethyl-1-(4-pentylphenyl)imidazol-4-yl]-2-piperidin-1-ylethanone.
| Compound Name | 1-[2,5-dimethyl-1-(4-pentylphenyl)imidazol-4-yl]-2-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 123457525 |
| Molecular Formula | C23H33N3O |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | 1-[2,5-dimethyl-1-(4-pentylphenyl)imidazol-4-yl]-2-piperidin-1-ylethanone |
| SMILES | CCCCCc1ccc(-n2c(C)nc(C(=O)CN3CCCCC3)c2C)cc1 |
| InChI | InChI=1S/C23H33N3O/c1-4-5-7-10-20-11-13-21(14-12-20)26-18(2)23(24-19(26)3)22(27)17-25-15-8-6-9-16-25/h11-14H,4-10,15-17H2,1-3H3 |
| InChIKey | GFCBYRFNQZTRPI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|