C23H26ClNO7S — CID 123871469
[9-acetyloxy-3-(3-chloropropylsulfonyl)-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate (PubChem CID 123871469) has the molecular formula C23H26ClNO7S and a molecular weight of 495.98 g/mol. Its IUPAC name is [9-acetyloxy-3-(3-chloropropylsulfonyl)-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate.
| Compound Name | [9-acetyloxy-3-(3-chloropropylsulfonyl)-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate |
|---|---|
| PubChem CID | 123871469 |
| Molecular Formula | C23H26ClNO7S |
| Molecular Weight | 495.98 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | [9-acetyloxy-3-(3-chloropropylsulfonyl)-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c3c1OC1C(OC(C)=O)C=CC4C(C2)N(S(=O)(=O)CCCCl)CCC341 |
| InChI | InChI=1S/C23H26ClNO7S/c1-13(26)30-18-6-4-15-12-17-16-5-7-19(31-14(2)27)22-23(16,20(15)21(18)32-22)8-10-25(17)33(28,29)11-3-9-24/h4-7,16-17,19,22H,3,8-12H2,1-2H3 |
| InChIKey | ICRXKRXKVRKAPL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.98 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|