C29H39CuNO7 — CID 67685371
[(4R,4aR,7S,7aR,12bS)-9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate;copper;2-ethylhexanoic acid (PubChem CID 67685371) has the molecular formula C29H39CuNO7 and a molecular weight of 577.18 g/mol. Its IUPAC name is [(4R,4aR,7S,7aR,12bS)-9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate;copper;2-ethylhexanoic acid.
| Compound Name | [(4R,4aR,7S,7aR,12bS)-9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate;copper;2-ethylhexanoic acid |
|---|---|
| PubChem CID | 67685371 |
| Molecular Formula | C29H39CuNO7 |
| Molecular Weight | 577.18 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | [(4R,4aR,7S,7aR,12bS)-9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate;copper;2-ethylhexanoic acid |
| SMILES | CC(=O)Oc1ccc2c3c1O[C@H]1[C@@H](OC(C)=O)C=C[C@H]4[C@@H](C2)N(C)CC[C@@]341.CCCCC(CC)C(=O)O.[Cu] |
| InChI | InChI=1S/C21H23NO5.C8H16O2.Cu/c1-11(23)25-16-6-4-13-10-15-14-5-7-17(26-12(2)24)20-21(14,8-9-22(15)3)18(13)19(16)27-20;1-3-5-6-7(4-2)8(9)10;/h4-7,14-15,17,20H,8-10H2,1-3H3;7H,3-6H2,1-2H3,(H,9,10);/t14-,15+,17-,20-,21-;;/m0../s1 |
| InChIKey | FWCGKZBRSDNVJT-NRXBBNKASA-N |
| XLogP | 4.27 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.18 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|