C18H24N2O — CID 123875744
1-[1-[1-(2-methylbut-2-enoxy)cyclopropyl]ethenyl]-3,4-dihydro-2H-1,5-naphthyridine (PubChem CID 123875744) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 1-[1-[1-(2-methylbut-2-enoxy)cyclopropyl]ethenyl]-3,4-dihydro-2H-1,5-naphthyridine.
| Compound Name | 1-[1-[1-(2-methylbut-2-enoxy)cyclopropyl]ethenyl]-3,4-dihydro-2H-1,5-naphthyridine |
|---|---|
| PubChem CID | 123875744 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 1-[1-[1-(2-methylbut-2-enoxy)cyclopropyl]ethenyl]-3,4-dihydro-2H-1,5-naphthyridine |
| SMILES | C=C(N1CCCc2ncccc21)C1(OCC(C)=CC)CC1 |
| InChI | InChI=1S/C18H24N2O/c1-4-14(2)13-21-18(9-10-18)15(3)20-12-6-7-16-17(20)8-5-11-19-16/h4-5,8,11H,3,6-7,9-10,12-13H2,1-2H3 |
| InChIKey | FKHWPIMIIYKQEF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|