C24H26F6N2O4 — CID 123876967
2-[[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydropyridin-5-yl]methyl]-6-methoxy-5-(3-methylmorpholin-4-yl)-2,3-dihydroinden-1-one (PubChem CID 123876967) has the molecular formula C24H26F6N2O4 and a molecular weight of 520.47 g/mol. Its IUPAC name is 2-[[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydropyridin-5-yl]methyl]-6-methoxy-5-(3-methylmorpholin-4-yl)-2,3-dihydroinden-1-one.
| Compound Name | 2-[[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydropyridin-5-yl]methyl]-6-methoxy-5-(3-methylmorpholin-4-yl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 123876967 |
| Molecular Formula | C24H26F6N2O4 |
| Molecular Weight | 520.47 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 2-[[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydropyridin-5-yl]methyl]-6-methoxy-5-(3-methylmorpholin-4-yl)-2,3-dihydroinden-1-one |
| SMILES | COc1cc2c(cc1N1CCOCC1C)CC(CC1=CC(C(O)(C(F)(F)F)C(F)(F)F)CN=C1)C2=O |
| InChI | InChI=1S/C24H26F6N2O4/c1-13-12-36-4-3-32(13)19-8-15-7-16(21(33)18(15)9-20(19)35-2)5-14-6-17(11-31-10-14)22(34,23(25,26)27)24(28,29)30/h6,8-10,13,16-17,34H,3-5,7,11-12H2,1-2H3 |
| InChIKey | GJMDDMKNTCOBSM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |