C25H26F9NO4 — CID 154986868
6-methoxy-5-morpholin-4-yl-2-[(3E,5E)-7,7,7-trifluoro-3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-6-methylhepta-3,5-dienyl]-2,3-dihydroinden-1-one (PubChem CID 154986868) has the molecular formula C25H26F9NO4 and a molecular weight of 575.47 g/mol. Its IUPAC name is 6-methoxy-5-morpholin-4-yl-2-[(3E,5E)-7,7,7-trifluoro-3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-6-methylhepta-3,5-dienyl]-2,3-dihydroinden-1-one.
| Compound Name | 6-methoxy-5-morpholin-4-yl-2-[(3E,5E)-7,7,7-trifluoro-3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-6-methylhepta-3,5-dienyl]-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 154986868 |
| Molecular Formula | C25H26F9NO4 |
| Molecular Weight | 575.47 g/mol |
| Exact Mass | 575.17 |
| IUPAC Name | 6-methoxy-5-morpholin-4-yl-2-[(3E,5E)-7,7,7-trifluoro-3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-6-methylhepta-3,5-dienyl]-2,3-dihydroinden-1-one |
| SMILES | COc1cc2c(cc1N1CCOCC1)CC(CC/C(=C\C=C(/C)C(F)(F)F)C(O)(C(F)(F)F)C(F)(F)F)C2=O |
| InChI | InChI=1S/C25H26F9NO4/c1-14(23(26,27)28)3-5-17(22(37,24(29,30)31)25(32,33)34)6-4-15-11-16-12-19(35-7-9-39-10-8-35)20(38-2)13-18(16)21(15)36/h3,5,12-13,15,37H,4,6-11H2,1-2H3/b14-3+,17-5+ |
| InChIKey | DPHXEQXQKOUEQZ-DMLHDEOASA-N |
| XLogP | 5.96 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.47 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|